What is methyl Butanoate used for?

It can be produced by distillation from essential oils of vegetable origin, but is also manufactured on a small scale for use in perfumes and as a food flavoring. Methyl butyrate has been used in combustion studies as a surrogate fuel for the larger fatty acid methyl esters found in biodiesel.

What is methyl Butanoate molecular formula?

C5H10O2
Methyl butyrate/Formula
Molecular Formula: C5H10O2. Element System: C-H-O. CAS-RN: 623-42-7. InChI: InChI=1S/C5H10O2/c1-3-4-5(6)7-2/h3-4H2,1-2H3.

What is the common name for methyl Butanoate?

Methyl butyrate
Methyl butyrate, also known under the systematic name methyl butanoate, is the methyl ester of butyric acid….CHEBI:88806.

SynonymsSources
Butanoic acid, methyl esterHMDB
Butyric acid, methyl esterHMDB
Methyl butanoateHMDB
methyl butanoateHMDB

What is the name of C3H7COOCH3?

Methyl butanoate (YMDB01743)

Identification
SynonymsButanoic acid, methyl ester Butyric acid, methyl ester Methyl butyrate Methyl ester of butanoic acid Methyl n-butanoate Methyl n-butyrate n-Butyric acid methyl ester n-C3H7COOCH3 Methyl butyric acid Methyl butanoate Methyl butanoic acid
CAS number623-42-7

What is Butanoate metabolism?

Butyrate metabolism (Butanoate metabolism) describes the metabolic fate of a number of short chain fatty acids or short chain alcohols that are typically produced by intestinal fermentation.

Why methyl Butanoate has a comparatively low boiling point?

Ester molecules are polar but have no hydrogen atom attached directly to an oxygen atom. They are therefore incapable of engaging in intermolecular hydrogen bonding with one another and thus have considerably lower boiling points than their isomeric carboxylic acids counterparts.

What odor does methyl Butanoate have?

fruity odor
Methyl butyrate (MB) is the methyl ester of butyric acid having a characteristic sweet and fruity odor like that of apples and pineapples. It occurs in many plant products in minute quantities and in pineapple oil.

How do you make methyl Butanoate?

The general word equation for the reaction is:alcohol (OH) + organic acid (COOH) → ester + waterFor example:methanol + butanoic acid → methyl butanoate + watermethyl= 1Cbutane= 4CThe alcohol (methanol) loose an H, and the carboxylic acid loose an OH which form the by product of this reaction = water The ester formed= …

What is the molar mass of methyl Butanoate?

102.13 g/mol
Methyl butyrate/Molar mass

Is butyric acid bad for you?

► Inhaling Butyric Acid can irritate the nose, throat and lungs. ► Butyric Acid is CORROSIVE. No occupational exposure limits have been established for Butyric Acid. However, it may pose a health risk.

How much butyric acid should I take?

150–300 mg/day is the most common dosage recommendation for currently available butyric acid products.

What is the importance of esters?

Phosphate esters are biologically important (nucleic acids belong to this group) and are used widely in industry as solvents, plasticizers, flame retardants, gasoline and oil additives, and insecticides. Esters of sulfuric and sulfurous acids are used in the manufacture of dyes and pharmaceuticals.

You Might Also Like